C23H30N8O3 — CID 70983411
tert-butyl N-[6-oxo-6-[[6-(6-pyridin-2-yl-1,4-dihydro-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]amino]hexyl]carbamate (PubChem CID 70983411) has the molecular formula C23H30N8O3 and a molecular weight of 466.55 g/mol. Its IUPAC name is tert-butyl N-[6-oxo-6-[[6-(6-pyridin-2-yl-1,4-dihydro-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-oxo-6-[[6-(6-pyridin-2-yl-1,4-dihydro-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 70983411 |
| Molecular Formula | C23H30N8O3 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | tert-butyl N-[6-oxo-6-[[6-(6-pyridin-2-yl-1,4-dihydro-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]amino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)Nc1ccc(C2=NNC(c3ccccn3)=NN2)nc1 |
| InChI | InChI=1S/C23H30N8O3/c1-23(2,3)34-22(33)25-14-7-4-5-10-19(32)27-16-11-12-18(26-15-16)21-30-28-20(29-31-21)17-9-6-8-13-24-17/h6,8-9,11-13,15H,4-5,7,10,14H2,1-3H3,(H,25,33)(H,27,32)(H,28,29)(H,30,31) |
| InChIKey | XXTDCRGOXIYZLH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|