C21H27FN4O3 — CID 75537481
tert-butyl N-[4-[[6-[(2-fluorophenyl)methylamino]-3-pyridinyl]amino]-4-oxobutyl]carbamate (PubChem CID 75537481) has the molecular formula C21H27FN4O3 and a molecular weight of 402.47 g/mol. Its IUPAC name is tert-butyl N-[4-[[6-[(2-fluorophenyl)methylamino]-3-pyridinyl]amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[[6-[(2-fluorophenyl)methylamino]-3-pyridinyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 75537481 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | tert-butyl N-[4-[[6-[(2-fluorophenyl)methylamino]-3-pyridinyl]amino]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)Nc1ccc(NCc2ccccc2F)nc1 |
| InChI | InChI=1S/C21H27FN4O3/c1-21(2,3)29-20(28)23-12-6-9-19(27)26-16-10-11-18(25-14-16)24-13-15-7-4-5-8-17(15)22/h4-5,7-8,10-11,14H,6,9,12-13H2,1-3H3,(H,23,28)(H,24,25)(H,26,27) |
| InChIKey | LQQCXUTZPBDZBW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|