C20H24N8O — CID 169281528
8-amino-N-[6-(6-pyridin-2-yl-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]octanamide (PubChem CID 169281528) has the molecular formula C20H24N8O and a molecular weight of 392.47 g/mol. Its IUPAC name is 8-amino-N-[6-(6-pyridin-2-yl-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]octanamide.
| Compound Name | 8-amino-N-[6-(6-pyridin-2-yl-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]octanamide |
|---|---|
| PubChem CID | 169281528 |
| Molecular Formula | C20H24N8O |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 8-amino-N-[6-(6-pyridin-2-yl-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]octanamide |
| SMILES | NCCCCCCCC(=O)Nc1ccc(-c2nnc(-c3ccccn3)nn2)nc1 |
| InChI | InChI=1S/C20H24N8O/c21-12-6-3-1-2-4-9-18(29)24-15-10-11-17(23-14-15)20-27-25-19(26-28-20)16-8-5-7-13-22-16/h5,7-8,10-11,13-14H,1-4,6,9,12,21H2,(H,24,29) |
| InChIKey | FAKRLDMPKJPPAJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|