C17H22N4O3S — CID 134363098
6-amino-N-[4-(pyridin-2-ylsulfamoyl)phenyl]hexanamide (PubChem CID 134363098) has the molecular formula C17H22N4O3S and a molecular weight of 362.45 g/mol. Its IUPAC name is 6-amino-N-[4-(pyridin-2-ylsulfamoyl)phenyl]hexanamide.
| Compound Name | 6-amino-N-[4-(pyridin-2-ylsulfamoyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 134363098 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 6-amino-N-[4-(pyridin-2-ylsulfamoyl)phenyl]hexanamide |
| SMILES | NCCCCCC(=O)Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C17H22N4O3S/c18-12-4-1-2-7-17(22)20-14-8-10-15(11-9-14)25(23,24)21-16-6-3-5-13-19-16/h3,5-6,8-11,13H,1-2,4,7,12,18H2,(H,19,21)(H,20,22) |
| InChIKey | VVHVEAQSBFHFGD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|