C24H27N3O4S — CID 19191432
4-(4-propylphenoxy)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]butanamide (PubChem CID 19191432) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is 4-(4-propylphenoxy)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]butanamide.
| Compound Name | 4-(4-propylphenoxy)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 19191432 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-(4-propylphenoxy)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]butanamide |
| SMILES | CCCc1ccc(OCCCC(=O)Nc2ccc(S(=O)(=O)Nc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O4S/c1-2-6-19-9-13-21(14-10-19)31-18-5-8-24(28)26-20-11-15-22(16-12-20)32(29,30)27-23-7-3-4-17-25-23/h3-4,7,9-17H,2,5-6,8,18H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | WZDOPSXUYBYRLF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|