C22H25N3O4S2 — CID 3868589
4-pentyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzenesulfonamide (PubChem CID 3868589) has the molecular formula C22H25N3O4S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 4-pentyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzenesulfonamide.
| Compound Name | 4-pentyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3868589 |
| Molecular Formula | C22H25N3O4S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 4-pentyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O4S2/c1-2-3-4-7-18-9-13-20(14-10-18)30(26,27)24-19-11-15-21(16-12-19)31(28,29)25-22-8-5-6-17-23-22/h5-6,8-17,24H,2-4,7H2,1H3,(H,23,25) |
| InChIKey | GSKPUADMNDGRMK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|