C24H28N2O2S — CID 84552335
N-(4-anilinophenyl)-4-hexylbenzenesulfonamide (PubChem CID 84552335) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is N-(4-anilinophenyl)-4-hexylbenzenesulfonamide.
| Compound Name | N-(4-anilinophenyl)-4-hexylbenzenesulfonamide |
|---|---|
| PubChem CID | 84552335 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-(4-anilinophenyl)-4-hexylbenzenesulfonamide |
| SMILES | CCCCCCc1ccc(S(=O)(=O)Nc2ccc(Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O2S/c1-2-3-4-6-9-20-12-18-24(19-13-20)29(27,28)26-23-16-14-22(15-17-23)25-21-10-7-5-8-11-21/h5,7-8,10-19,25-26H,2-4,6,9H2,1H3 |
| InChIKey | CHGBQLCLEKCNDP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|