C23H24N2O3S — CID 2231369
4-(benzenesulfonamido)-N-(4-butylphenyl)benzamide (PubChem CID 2231369) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-(4-butylphenyl)benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-(4-butylphenyl)benzamide |
|---|---|
| PubChem CID | 2231369 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 4-(benzenesulfonamido)-N-(4-butylphenyl)benzamide |
| SMILES | CCCCc1ccc(NC(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O3S/c1-2-3-7-18-10-14-20(15-11-18)24-23(26)19-12-16-21(17-13-19)25-29(27,28)22-8-5-4-6-9-22/h4-6,8-17,25H,2-3,7H2,1H3,(H,24,26) |
| InChIKey | OSDJISAMPWIARD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |