C25H27NO4S — CID 68688780
3-[2-[4-[(4-butylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68688780) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is 3-[2-[4-[(4-butylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 3-[2-[4-[(4-butylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68688780 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-[2-[4-[(4-butylphenyl)sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2ccc(CCc3cccc(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C25H27NO4S/c1-2-3-5-19-12-16-24(17-13-19)31(29,30)26-23-14-10-20(11-15-23)8-9-21-6-4-7-22(18-21)25(27)28/h4,6-7,10-18,26H,2-3,5,8-9H2,1H3,(H,27,28) |
| InChIKey | PWCOTNAIIKJQSN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |