C17H19NO5S — CID 2133735
5-[(4-butylphenyl)sulfamoyl]-2-hydroxybenzoic acid (PubChem CID 2133735) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is 5-[(4-butylphenyl)sulfamoyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(4-butylphenyl)sulfamoyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 2133735 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-[(4-butylphenyl)sulfamoyl]-2-hydroxybenzoic acid |
| SMILES | CCCCc1ccc(NS(=O)(=O)c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H19NO5S/c1-2-3-4-12-5-7-13(8-6-12)18-24(22,23)14-9-10-16(19)15(11-14)17(20)21/h5-11,18-19H,2-4H2,1H3,(H,20,21) |
| InChIKey | AJISVEXLPBAKLT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |