C20H16N2O10S2 — CID 25046771
5-[[4-[(3-carboxy-4-hydroxyphenyl)sulfonylamino]phenyl]sulfamoyl]-2-hydroxybenzoic acid (PubChem CID 25046771) has the molecular formula C20H16N2O10S2 and a molecular weight of 508.49 g/mol. Its IUPAC name is 5-[[4-[(3-carboxy-4-hydroxyphenyl)sulfonylamino]phenyl]sulfamoyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[(3-carboxy-4-hydroxyphenyl)sulfonylamino]phenyl]sulfamoyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 25046771 |
| Molecular Formula | C20H16N2O10S2 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 5-[[4-[(3-carboxy-4-hydroxyphenyl)sulfonylamino]phenyl]sulfamoyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ccc(NS(=O)(=O)c3ccc(O)c(C(=O)O)c3)cc2)ccc1O |
| InChI | InChI=1S/C20H16N2O10S2/c23-17-7-5-13(9-15(17)19(25)26)33(29,30)21-11-1-2-12(4-3-11)22-34(31,32)14-6-8-18(24)16(10-14)20(27)28/h1-10,21-24H,(H,25,26)(H,27,28) |
| InChIKey | YKWWWVVMODZSRP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|