C14H13NO5S — CID 2133740
2-hydroxy-5-[(4-methylphenyl)sulfamoyl]benzoic acid (PubChem CID 2133740) has the molecular formula C14H13NO5S and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-hydroxy-5-[(4-methylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[(4-methylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 2133740 |
| Molecular Formula | C14H13NO5S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-hydroxy-5-[(4-methylphenyl)sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C14H13NO5S/c1-9-2-4-10(5-3-9)15-21(19,20)11-6-7-13(16)12(8-11)14(17)18/h2-8,15-16H,1H3,(H,17,18) |
| InChIKey | VRDPYHDVZAMINE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |