C21H19NO5S — CID 72695676
2-hydroxy-5-[[4-(2-phenylethyl)phenyl]sulfamoyl]benzoic acid (PubChem CID 72695676) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-hydroxy-5-[[4-(2-phenylethyl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[[4-(2-phenylethyl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 72695676 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-hydroxy-5-[[4-(2-phenylethyl)phenyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ccc(CCc3ccccc3)cc2)ccc1O |
| InChI | InChI=1S/C21H19NO5S/c23-20-13-12-18(14-19(20)21(24)25)28(26,27)22-17-10-8-16(9-11-17)7-6-15-4-2-1-3-5-15/h1-5,8-14,22-23H,6-7H2,(H,24,25) |
| InChIKey | GIXMBQJKUBQPFB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |