C21H25NO5S — CID 118202362
5-[[4-(1-cyclohexylethyl)phenyl]sulfamoyl]-2-hydroxybenzoic acid (PubChem CID 118202362) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is 5-[[4-(1-cyclohexylethyl)phenyl]sulfamoyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-(1-cyclohexylethyl)phenyl]sulfamoyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 118202362 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 5-[[4-(1-cyclohexylethyl)phenyl]sulfamoyl]-2-hydroxybenzoic acid |
| SMILES | CC(c1ccc(NS(=O)(=O)c2ccc(O)c(C(=O)O)c2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C21H25NO5S/c1-14(15-5-3-2-4-6-15)16-7-9-17(10-8-16)22-28(26,27)18-11-12-20(23)19(13-18)21(24)25/h7-15,22-23H,2-6H2,1H3,(H,24,25) |
| InChIKey | OBVXEKWOZPKBCY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |