C14H12N2O10S2 — CID 170854611
5-[[(3-carboxy-4-hydroxyphenyl)sulfonylamino]sulfamoyl]-2-hydroxybenzoic acid (PubChem CID 170854611) has the molecular formula C14H12N2O10S2 and a molecular weight of 432.39 g/mol. Its IUPAC name is 5-[[(3-carboxy-4-hydroxyphenyl)sulfonylamino]sulfamoyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[(3-carboxy-4-hydroxyphenyl)sulfonylamino]sulfamoyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 170854611 |
| Molecular Formula | C14H12N2O10S2 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 5-[[(3-carboxy-4-hydroxyphenyl)sulfonylamino]sulfamoyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NNS(=O)(=O)c2ccc(O)c(C(=O)O)c2)ccc1O |
| InChI | InChI=1S/C14H12N2O10S2/c17-11-3-1-7(5-9(11)13(19)20)27(23,24)15-16-28(25,26)8-2-4-12(18)10(6-8)14(21)22/h1-6,15-18H,(H,19,20)(H,21,22) |
| InChIKey | IEIDHXXPPBELQW-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|