5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid

C13H19NO5S — CID 104827574

IUPAC5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid
SMILESCC(NS(=O)(=O)c1ccc(O)c(C(=O)O)c1)C(C)(C)C
InChIInChI=1S/C13H19NO5S/c1-8(13(2,3)4)14-20(18,19)9-5-6-11(15)10(7-9)12(16)17/h5-8,14-15H,1-4H3,(H,16,17)
InChIKeyWTSCEBJZXQHVJW-UHFFFAOYSA-N
MW301.36 g/mol
LogP1.80
Rot. Bonds4

About 5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid

5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid (PubChem CID 104827574) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid.

Molecular Properties

Compound Name5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid
PubChem CID104827574
Molecular FormulaC13H19NO5S
Molecular Weight301.36 g/mol
Exact Mass301.10
IUPAC Name5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid
SMILESCC(NS(=O)(=O)c1ccc(O)c(C(=O)O)c1)C(C)(C)C
InChIInChI=1S/C13H19NO5S/c1-8(13(2,3)4)14-20(18,19)9-5-6-11(15)10(7-9)12(16)17/h5-8,14-15H,1-4H3,(H,16,17)
InChIKeyWTSCEBJZXQHVJW-UHFFFAOYSA-N
XLogP1.80
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.36
LogP ≤ 51.80
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid?
The IUPAC name of 5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid (CID 104827574) is 5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid.
What is the SMILES notation for 5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid?
The canonical SMILES for 5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid is CC(NS(=O)(=O)c1ccc(O)c(C(=O)O)c1)C(C)(C)C.
What is the InChIKey of 5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid?
The InChIKey is WTSCEBJZXQHVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO5S/c1-8(13(2,3)4)14-20(18,19)9-5-6-11(15)10(7-9)12(16)17/h5-8,14-15H,1-4H3,(H,16,17).
What are the key properties of 5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid?
5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid has a molecular weight of 301.36 g/mol, XLogP of 1.80, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-dimethylbutan-2-ylsulfamoyl)-2-hydroxybenzoic acid is sourced from PubChem (CID 104827574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).