C13H21NO2S — CID 11637441
N-[(2R)-3,3-dimethylbutan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 11637441) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is N-[(2R)-3,3-dimethylbutan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2R)-3,3-dimethylbutan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11637441 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-[(2R)-3,3-dimethylbutan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C13H21NO2S/c1-10-6-8-12(9-7-10)17(15,16)14-11(2)13(3,4)5/h6-9,11,14H,1-5H3/t11-/m1/s1 |
| InChIKey | SCMZEUXTSUQPPF-LLVKDONJSA-N |
| XLogP | 2.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |