C11H19N3O2S — CID 104827316
6-amino-N-(3,3-dimethylbutan-2-yl)pyridine-3-sulfonamide (PubChem CID 104827316) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 6-amino-N-(3,3-dimethylbutan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-N-(3,3-dimethylbutan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 104827316 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 6-amino-N-(3,3-dimethylbutan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(N)nc1)C(C)(C)C |
| InChI | InChI=1S/C11H19N3O2S/c1-8(11(2,3)4)14-17(15,16)9-5-6-10(12)13-7-9/h5-8,14H,1-4H3,(H2,12,13) |
| InChIKey | FKTMXUNHMJVRDN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |