2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid

C14H21NO5S — CID 104827593

IUPAC2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid
SMILESCC(NS(=O)(=O)c1ccc(OCC(=O)O)cc1)C(C)(C)C
InChIInChI=1S/C14H21NO5S/c1-10(14(2,3)4)15-21(18,19)12-7-5-11(6-8-12)20-9-13(16)17/h5-8,10,15H,9H2,1-4H3,(H,16,17)
InChIKeyOJXQTNMCGSHARK-UHFFFAOYSA-N
MW315.39 g/mol
LogP1.86
Rot. Bonds6

About 2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid

2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid (PubChem CID 104827593) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid
PubChem CID104827593
Molecular FormulaC14H21NO5S
Molecular Weight315.39 g/mol
Exact Mass315.11
IUPAC Name2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid
SMILESCC(NS(=O)(=O)c1ccc(OCC(=O)O)cc1)C(C)(C)C
InChIInChI=1S/C14H21NO5S/c1-10(14(2,3)4)15-21(18,19)12-7-5-11(6-8-12)20-9-13(16)17/h5-8,10,15H,9H2,1-4H3,(H,16,17)
InChIKeyOJXQTNMCGSHARK-UHFFFAOYSA-N
XLogP1.86
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.39
LogP ≤ 51.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid?
The IUPAC name of 2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid (CID 104827593) is 2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid.
What is the SMILES notation for 2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid?
The canonical SMILES for 2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid is CC(NS(=O)(=O)c1ccc(OCC(=O)O)cc1)C(C)(C)C.
What is the InChIKey of 2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid?
The InChIKey is OJXQTNMCGSHARK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO5S/c1-10(14(2,3)4)15-21(18,19)12-7-5-11(6-8-12)20-9-13(16)17/h5-8,10,15H,9H2,1-4H3,(H,16,17).
What are the key properties of 2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid?
2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid has a molecular weight of 315.39 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,3-dimethylbutan-2-ylsulfamoyl)phenoxy]acetic acid is sourced from PubChem (CID 104827593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).