C15H21NO6S — CID 154743450
2-[4-[1-(oxan-4-yl)ethylsulfamoyl]phenoxy]acetic acid (PubChem CID 154743450) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-[4-[1-(oxan-4-yl)ethylsulfamoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[1-(oxan-4-yl)ethylsulfamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 154743450 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[4-[1-(oxan-4-yl)ethylsulfamoyl]phenoxy]acetic acid |
| SMILES | CC(NS(=O)(=O)c1ccc(OCC(=O)O)cc1)C1CCOCC1 |
| InChI | InChI=1S/C15H21NO6S/c1-11(12-6-8-21-9-7-12)16-23(19,20)14-4-2-13(3-5-14)22-10-15(17)18/h2-5,11-12,16H,6-10H2,1H3,(H,17,18) |
| InChIKey | KBWMPDROXFMGPV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |