C13H17Cl2NO4S — CID 104827579
2,5-dichloro-3-(3,3-dimethylbutan-2-ylsulfamoyl)benzoic acid (PubChem CID 104827579) has the molecular formula C13H17Cl2NO4S and a molecular weight of 354.26 g/mol. Its IUPAC name is 2,5-dichloro-3-(3,3-dimethylbutan-2-ylsulfamoyl)benzoic acid.
| Compound Name | 2,5-dichloro-3-(3,3-dimethylbutan-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 104827579 |
| Molecular Formula | C13H17Cl2NO4S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2,5-dichloro-3-(3,3-dimethylbutan-2-ylsulfamoyl)benzoic acid |
| SMILES | CC(NS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl)C(C)(C)C |
| InChI | InChI=1S/C13H17Cl2NO4S/c1-7(13(2,3)4)16-21(19,20)10-6-8(14)5-9(11(10)15)12(17)18/h5-7,16H,1-4H3,(H,17,18) |
| InChIKey | XDNYJDFRBWTFAV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |