C9H9Cl2NO5S — CID 64973993
2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid (PubChem CID 64973993) has the molecular formula C9H9Cl2NO5S and a molecular weight of 314.15 g/mol. Its IUPAC name is 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid.
| Compound Name | 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 64973993 |
| Molecular Formula | C9H9Cl2NO5S |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid |
| SMILES | CCONS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl |
| InChI | InChI=1S/C9H9Cl2NO5S/c1-2-17-12-18(15,16)7-4-5(10)3-6(8(7)11)9(13)14/h3-4,12H,2H2,1H3,(H,13,14) |
| InChIKey | PTWLNKQGBVFWCP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|