2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid

C9H9Cl2NO5S — CID 64973993

IUPAC2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid
SMILESCCONS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl
InChIInChI=1S/C9H9Cl2NO5S/c1-2-17-12-18(15,16)7-4-5(10)3-6(8(7)11)9(13)14/h3-4,12H,2H2,1H3,(H,13,14)
InChIKeyPTWLNKQGBVFWCP-UHFFFAOYSA-N
MW314.15 g/mol
LogP1.92
Rot. Bonds5

About 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid

2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid (PubChem CID 64973993) has the molecular formula C9H9Cl2NO5S and a molecular weight of 314.15 g/mol. Its IUPAC name is 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid.

Molecular Properties

Compound Name2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid
PubChem CID64973993
Molecular FormulaC9H9Cl2NO5S
Molecular Weight314.15 g/mol
Exact Mass312.96
IUPAC Name2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid
SMILESCCONS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl
InChIInChI=1S/C9H9Cl2NO5S/c1-2-17-12-18(15,16)7-4-5(10)3-6(8(7)11)9(13)14/h3-4,12H,2H2,1H3,(H,13,14)
InChIKeyPTWLNKQGBVFWCP-UHFFFAOYSA-N
XLogP1.92
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.15
LogP ≤ 51.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid?
The IUPAC name of 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid (CID 64973993) is 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid.
What is the SMILES notation for 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid?
The canonical SMILES for 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid is CCONS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl.
What is the InChIKey of 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid?
The InChIKey is PTWLNKQGBVFWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2NO5S/c1-2-17-12-18(15,16)7-4-5(10)3-6(8(7)11)9(13)14/h3-4,12H,2H2,1H3,(H,13,14).
What are the key properties of 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid?
2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid has a molecular weight of 314.15 g/mol, XLogP of 1.92, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-3-(ethoxysulfamoyl)benzoic acid is sourced from PubChem (CID 64973993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).