C11H11Cl2NO5S — CID 62900058
3-(1-amino-1-oxobutan-2-yl)sulfonyl-2,5-dichlorobenzoic acid (PubChem CID 62900058) has the molecular formula C11H11Cl2NO5S and a molecular weight of 340.18 g/mol. Its IUPAC name is 3-(1-amino-1-oxobutan-2-yl)sulfonyl-2,5-dichlorobenzoic acid.
| Compound Name | 3-(1-amino-1-oxobutan-2-yl)sulfonyl-2,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 62900058 |
| Molecular Formula | C11H11Cl2NO5S |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 3-(1-amino-1-oxobutan-2-yl)sulfonyl-2,5-dichlorobenzoic acid |
| SMILES | CCC(C(N)=O)S(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl |
| InChI | InChI=1S/C11H11Cl2NO5S/c1-2-7(10(14)15)20(18,19)8-4-5(12)3-6(9(8)13)11(16)17/h3-4,7H,2H2,1H3,(H2,14,15)(H,16,17) |
| InChIKey | LTYHBECECYACBI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |