C11H12Cl2O6S2 — CID 43808002
2,5-dichloro-3-(2-ethylsulfonylethylsulfonyl)benzoic acid (PubChem CID 43808002) has the molecular formula C11H12Cl2O6S2 and a molecular weight of 375.25 g/mol. Its IUPAC name is 2,5-dichloro-3-(2-ethylsulfonylethylsulfonyl)benzoic acid.
| Compound Name | 2,5-dichloro-3-(2-ethylsulfonylethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 43808002 |
| Molecular Formula | C11H12Cl2O6S2 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 2,5-dichloro-3-(2-ethylsulfonylethylsulfonyl)benzoic acid |
| SMILES | CCS(=O)(=O)CCS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl |
| InChI | InChI=1S/C11H12Cl2O6S2/c1-2-20(16,17)3-4-21(18,19)9-6-7(12)5-8(10(9)13)11(14)15/h5-6H,2-4H2,1H3,(H,14,15) |
| InChIKey | ROAUCJLEQRONQN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |