C13H17Cl2NO4S — CID 62117802
2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid (PubChem CID 62117802) has the molecular formula C13H17Cl2NO4S and a molecular weight of 354.26 g/mol. Its IUPAC name is 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid.
| Compound Name | 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 62117802 |
| Molecular Formula | C13H17Cl2NO4S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid |
| SMILES | CCCC(CC)NS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl |
| InChI | InChI=1S/C13H17Cl2NO4S/c1-3-5-9(4-2)16-21(19,20)11-7-8(14)6-10(12(11)15)13(17)18/h6-7,9,16H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | POSVZIWMKMGMHI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |