2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid

C13H17Cl2NO4S — CID 62117802

IUPAC2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid
SMILESCCCC(CC)NS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl
InChIInChI=1S/C13H17Cl2NO4S/c1-3-5-9(4-2)16-21(19,20)11-7-8(14)6-10(12(11)15)13(17)18/h6-7,9,16H,3-5H2,1-2H3,(H,17,18)
InChIKeyPOSVZIWMKMGMHI-UHFFFAOYSA-N
MW354.26 g/mol
LogP3.55
Rot. Bonds7

About 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid

2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid (PubChem CID 62117802) has the molecular formula C13H17Cl2NO4S and a molecular weight of 354.26 g/mol. Its IUPAC name is 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid.

Molecular Properties

Compound Name2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid
PubChem CID62117802
Molecular FormulaC13H17Cl2NO4S
Molecular Weight354.26 g/mol
Exact Mass353.03
IUPAC Name2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid
SMILESCCCC(CC)NS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl
InChIInChI=1S/C13H17Cl2NO4S/c1-3-5-9(4-2)16-21(19,20)11-7-8(14)6-10(12(11)15)13(17)18/h6-7,9,16H,3-5H2,1-2H3,(H,17,18)
InChIKeyPOSVZIWMKMGMHI-UHFFFAOYSA-N
XLogP3.55
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500354.26
LogP ≤ 53.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid?
The IUPAC name of 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid (CID 62117802) is 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid.
What is the SMILES notation for 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid?
The canonical SMILES for 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid is CCCC(CC)NS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl.
What is the InChIKey of 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid?
The InChIKey is POSVZIWMKMGMHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Cl2NO4S/c1-3-5-9(4-2)16-21(19,20)11-7-8(14)6-10(12(11)15)13(17)18/h6-7,9,16H,3-5H2,1-2H3,(H,17,18).
What are the key properties of 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid?
2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid has a molecular weight of 354.26 g/mol, XLogP of 3.55, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-3-(hexan-3-ylsulfamoyl)benzoic acid is sourced from PubChem (CID 62117802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).