C14H20BrNO4S — CID 79576120
3-bromo-5-(hexan-3-ylsulfamoyl)-2-methylbenzoic acid (PubChem CID 79576120) has the molecular formula C14H20BrNO4S and a molecular weight of 378.29 g/mol. Its IUPAC name is 3-bromo-5-(hexan-3-ylsulfamoyl)-2-methylbenzoic acid.
| Compound Name | 3-bromo-5-(hexan-3-ylsulfamoyl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 79576120 |
| Molecular Formula | C14H20BrNO4S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 3-bromo-5-(hexan-3-ylsulfamoyl)-2-methylbenzoic acid |
| SMILES | CCCC(CC)NS(=O)(=O)c1cc(Br)c(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H20BrNO4S/c1-4-6-10(5-2)16-21(19,20)11-7-12(14(17)18)9(3)13(15)8-11/h7-8,10,16H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | WRDQHFNNTHMTEZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |