C12H11BrClNO4S — CID 106224172
3-bromo-2-chloro-5-(pent-1-yn-3-ylsulfamoyl)benzoic acid (PubChem CID 106224172) has the molecular formula C12H11BrClNO4S and a molecular weight of 380.65 g/mol. Its IUPAC name is 3-bromo-2-chloro-5-(pent-1-yn-3-ylsulfamoyl)benzoic acid.
| Compound Name | 3-bromo-2-chloro-5-(pent-1-yn-3-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 106224172 |
| Molecular Formula | C12H11BrClNO4S |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 378.93 |
| IUPAC Name | 3-bromo-2-chloro-5-(pent-1-yn-3-ylsulfamoyl)benzoic acid |
| SMILES | C#CC(CC)NS(=O)(=O)c1cc(Br)c(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H11BrClNO4S/c1-3-7(4-2)15-20(18,19)8-5-9(12(16)17)11(14)10(13)6-8/h1,5-7,15H,4H2,2H3,(H,16,17) |
| InChIKey | FMNSCBDQIXXYLV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|