C11H13NO4S2 — CID 114160472
5-methyl-4-(pent-1-yn-3-ylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 114160472) has the molecular formula C11H13NO4S2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 5-methyl-4-(pent-1-yn-3-ylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 5-methyl-4-(pent-1-yn-3-ylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114160472 |
| Molecular Formula | C11H13NO4S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 5-methyl-4-(pent-1-yn-3-ylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | C#CC(CC)NS(=O)(=O)c1cc(C(=O)O)sc1C |
| InChI | InChI=1S/C11H13NO4S2/c1-4-8(5-2)12-18(15,16)10-6-9(11(13)14)17-7(10)3/h1,6,8,12H,5H2,2-3H3,(H,13,14) |
| InChIKey | ADMFFMUZPYHRBA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|