C9H11N5O4S2 — CID 63329135
5-methyl-4-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 63329135) has the molecular formula C9H11N5O4S2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 5-methyl-4-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-methyl-4-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63329135 |
| Molecular Formula | C9H11N5O4S2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 5-methyl-4-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1S(=O)(=O)NC(C)c1nn[nH]n1 |
| InChI | InChI=1S/C9H11N5O4S2/c1-4(8-10-13-14-11-8)12-20(17,18)7-3-6(9(15)16)19-5(7)2/h3-4,12H,1-2H3,(H,15,16)(H,10,11,13,14) |
| InChIKey | ZXYAUBISTCCCID-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |