C13H21NO4S2 — CID 63328950
5-methyl-4-(5-methylhexan-2-ylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 63328950) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 5-methyl-4-(5-methylhexan-2-ylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 5-methyl-4-(5-methylhexan-2-ylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63328950 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 5-methyl-4-(5-methylhexan-2-ylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1S(=O)(=O)NC(C)CCC(C)C |
| InChI | InChI=1S/C13H21NO4S2/c1-8(2)5-6-9(3)14-20(17,18)12-7-11(13(15)16)19-10(12)4/h7-9,14H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | XSQYOHXSAAOBOI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |