C9H14N2O6S3 — CID 63328601
4-[2-(methanesulfonamido)ethylsulfamoyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 63328601) has the molecular formula C9H14N2O6S3 and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[2-(methanesulfonamido)ethylsulfamoyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[2-(methanesulfonamido)ethylsulfamoyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63328601 |
| Molecular Formula | C9H14N2O6S3 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 4-[2-(methanesulfonamido)ethylsulfamoyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1S(=O)(=O)NCCNS(C)(=O)=O |
| InChI | InChI=1S/C9H14N2O6S3/c1-6-8(5-7(18-6)9(12)13)20(16,17)11-4-3-10-19(2,14)15/h5,10-11H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | PSVBVLZERXTVMZ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|