C13H13NO5S2 — CID 114331362
4-[(2-hydroxyphenyl)methylsulfamoyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 114331362) has the molecular formula C13H13NO5S2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[(2-hydroxyphenyl)methylsulfamoyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[(2-hydroxyphenyl)methylsulfamoyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114331362 |
| Molecular Formula | C13H13NO5S2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 4-[(2-hydroxyphenyl)methylsulfamoyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1S(=O)(=O)NCc1ccccc1O |
| InChI | InChI=1S/C13H13NO5S2/c1-8-12(6-11(20-8)13(16)17)21(18,19)14-7-9-4-2-3-5-10(9)15/h2-6,14-15H,7H2,1H3,(H,16,17) |
| InChIKey | LWCLSEGGWREMIX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|