C11H17NO5S2 — CID 65105337
4-[(2-hydroxy-2-methylbutyl)sulfamoyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 65105337) has the molecular formula C11H17NO5S2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-[(2-hydroxy-2-methylbutyl)sulfamoyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[(2-hydroxy-2-methylbutyl)sulfamoyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 65105337 |
| Molecular Formula | C11H17NO5S2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-[(2-hydroxy-2-methylbutyl)sulfamoyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | CCC(C)(O)CNS(=O)(=O)c1cc(C(=O)O)sc1C |
| InChI | InChI=1S/C11H17NO5S2/c1-4-11(3,15)6-12-19(16,17)9-5-8(10(13)14)18-7(9)2/h5,12,15H,4,6H2,1-3H3,(H,13,14) |
| InChIKey | RCDOBRYNCQHQKS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |