C11H17NO6S2 — CID 63329093
4-[2-(2-methoxyethoxy)ethylsulfamoyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 63329093) has the molecular formula C11H17NO6S2 and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-[2-(2-methoxyethoxy)ethylsulfamoyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[2-(2-methoxyethoxy)ethylsulfamoyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63329093 |
| Molecular Formula | C11H17NO6S2 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 4-[2-(2-methoxyethoxy)ethylsulfamoyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | COCCOCCNS(=O)(=O)c1cc(C(=O)O)sc1C |
| InChI | InChI=1S/C11H17NO6S2/c1-8-10(7-9(19-8)11(13)14)20(15,16)12-3-4-18-6-5-17-2/h7,12H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | UIIUPGCEQXTUPB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|