C13H17N3O5S2 — CID 6503042
4-(2-methoxyethylsulfamoyl)-5-methyl-N-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carboxamide (PubChem CID 6503042) has the molecular formula C13H17N3O5S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfamoyl)-5-methyl-N-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carboxamide.
| Compound Name | 4-(2-methoxyethylsulfamoyl)-5-methyl-N-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503042 |
| Molecular Formula | C13H17N3O5S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 4-(2-methoxyethylsulfamoyl)-5-methyl-N-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carboxamide |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)Nc2cc(C)on2)sc1C |
| InChI | InChI=1S/C13H17N3O5S2/c1-8-6-12(16-21-8)15-13(17)10-7-11(9(2)22-10)23(18,19)14-4-5-20-3/h6-7,14H,4-5H2,1-3H3,(H,15,16,17) |
| InChIKey | BIFNDVKYQOOAOD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|