C9H16N3O3+ — CID 7391237
2-methoxyethyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]azanium (PubChem CID 7391237) has the molecular formula C9H16N3O3+ and a molecular weight of 214.24 g/mol. Its IUPAC name is 2-methoxyethyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]azanium.
| Compound Name | 2-methoxyethyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7391237 |
| Molecular Formula | C9H16N3O3+ |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-methoxyethyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]azanium |
| SMILES | COCC[NH2+]CC(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C9H15N3O3/c1-7-5-8(12-15-7)11-9(13)6-10-3-4-14-2/h5,10H,3-4,6H2,1-2H3,(H,11,12,13)/p+1 |
| InChIKey | AMWRASLDFLKBIC-UHFFFAOYSA-O |
| XLogP | -0.87 |
| TPSA | 80.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|