C17H23N3O5 — CID 94031272
1-[(1R)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 94031272) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-[(1R)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-[(1R)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 94031272 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[(1R)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | COCCOc1ccc([C@@H](C)NC(=O)Nc2cc(C)on2)cc1OC |
| InChI | InChI=1S/C17H23N3O5/c1-11-9-16(20-25-11)19-17(21)18-12(2)13-5-6-14(15(10-13)23-4)24-8-7-22-3/h5-6,9-10,12H,7-8H2,1-4H3,(H2,18,19,20,21)/t12-/m1/s1 |
| InChIKey | JTWGNUWWEHLADL-GFCCVEGCSA-N |
| XLogP | 2.90 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|