C15H21F3N2O4 — CID 55809027
1-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 55809027) has the molecular formula C15H21F3N2O4 and a molecular weight of 350.34 g/mol. Its IUPAC name is 1-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 55809027 |
| Molecular Formula | C15H21F3N2O4 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | COCCOc1ccc(C(C)NC(=O)NCC(F)(F)F)cc1OC |
| InChI | InChI=1S/C15H21F3N2O4/c1-10(20-14(21)19-9-15(16,17)18)11-4-5-12(13(8-11)23-3)24-7-6-22-2/h4-5,8,10H,6-7,9H2,1-3H3,(H2,19,20,21) |
| InChIKey | YBLCKOZWAUPEIH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|