C16H19N3O6 — CID 108956802
N'-(5-methyl-1,2-oxazol-3-yl)-N-(3,4,5-trimethoxyphenyl)propanediamide (PubChem CID 108956802) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is N'-(5-methyl-1,2-oxazol-3-yl)-N-(3,4,5-trimethoxyphenyl)propanediamide.
| Compound Name | N'-(5-methyl-1,2-oxazol-3-yl)-N-(3,4,5-trimethoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 108956802 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N'-(5-methyl-1,2-oxazol-3-yl)-N-(3,4,5-trimethoxyphenyl)propanediamide |
| SMILES | COc1cc(NC(=O)CC(=O)Nc2cc(C)on2)cc(OC)c1OC |
| InChI | InChI=1S/C16H19N3O6/c1-9-5-13(19-25-9)18-15(21)8-14(20)17-10-6-11(22-2)16(24-4)12(7-10)23-3/h5-7H,8H2,1-4H3,(H,17,20)(H,18,19,21) |
| InChIKey | IOCXBKAARLSCQP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|