C18H19ClN2O5 — CID 108954919
N-(2-chlorophenyl)-N'-(3,4,5-trimethoxyphenyl)propanediamide (PubChem CID 108954919) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-(3,4,5-trimethoxyphenyl)propanediamide.
| Compound Name | N-(2-chlorophenyl)-N'-(3,4,5-trimethoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 108954919 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-(2-chlorophenyl)-N'-(3,4,5-trimethoxyphenyl)propanediamide |
| SMILES | COc1cc(NC(=O)CC(=O)Nc2ccccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H19ClN2O5/c1-24-14-8-11(9-15(25-2)18(14)26-3)20-16(22)10-17(23)21-13-7-5-4-6-12(13)19/h4-9H,10H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | QPKBIQSAVOUPBE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|