C21H28N4O6S — CID 55572871
1-[5-(2-methoxyethylsulfamoyl)-2-methylbenzoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide (PubChem CID 55572871) has the molecular formula C21H28N4O6S and a molecular weight of 464.54 g/mol. Its IUPAC name is 1-[5-(2-methoxyethylsulfamoyl)-2-methylbenzoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide.
| Compound Name | 1-[5-(2-methoxyethylsulfamoyl)-2-methylbenzoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55572871 |
| Molecular Formula | C21H28N4O6S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 1-[5-(2-methoxyethylsulfamoyl)-2-methylbenzoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)N2CCC(C(=O)Nc3cc(C)on3)CC2)c1 |
| InChI | InChI=1S/C21H28N4O6S/c1-14-4-5-17(32(28,29)22-8-11-30-3)13-18(14)21(27)25-9-6-16(7-10-25)20(26)23-19-12-15(2)31-24-19/h4-5,12-13,16,22H,6-11H2,1-3H3,(H,23,24,26) |
| InChIKey | UOQWYPSYFOHERW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|