C18H30ClN3O4S — CID 119394953
N-(2-methoxyethyl)-4-methyl-3-[3-(methylaminomethyl)piperidine-1-carbonyl]benzenesulfonamide;hydrochloride (PubChem CID 119394953) has the molecular formula C18H30ClN3O4S and a molecular weight of 419.98 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-methyl-3-[3-(methylaminomethyl)piperidine-1-carbonyl]benzenesulfonamide;hydrochloride.
| Compound Name | N-(2-methoxyethyl)-4-methyl-3-[3-(methylaminomethyl)piperidine-1-carbonyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119394953 |
| Molecular Formula | C18H30ClN3O4S |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-(2-methoxyethyl)-4-methyl-3-[3-(methylaminomethyl)piperidine-1-carbonyl]benzenesulfonamide;hydrochloride |
| SMILES | CNCC1CCCN(C(=O)c2cc(S(=O)(=O)NCCOC)ccc2C)C1.Cl |
| InChI | InChI=1S/C18H29N3O4S.ClH/c1-14-6-7-16(26(23,24)20-8-10-25-3)11-17(14)18(22)21-9-4-5-15(13-21)12-19-2;/h6-7,11,15,19-20H,4-5,8-10,12-13H2,1-3H3;1H |
| InChIKey | NKFQOFUVOQOBCP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|