C20H29N3O6S — CID 55347495
N-(2-methoxyethyl)-4-methyl-3-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]benzenesulfonamide (PubChem CID 55347495) has the molecular formula C20H29N3O6S and a molecular weight of 439.53 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-methyl-3-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-4-methyl-3-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55347495 |
| Molecular Formula | C20H29N3O6S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-(2-methoxyethyl)-4-methyl-3-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)N2CCN(C(=O)C3CCCO3)CC2)c1 |
| InChI | InChI=1S/C20H29N3O6S/c1-15-5-6-16(30(26,27)21-7-13-28-2)14-17(15)19(24)22-8-10-23(11-9-22)20(25)18-4-3-12-29-18/h5-6,14,18,21H,3-4,7-13H2,1-2H3 |
| InChIKey | KFHAOVDZPWLWHZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|