C24H33N3O6S — CID 43017406
N-(2-methoxyethyl)-3-[4-[2-(4-methoxyphenoxy)ethyl]piperazine-1-carbonyl]-4-methylbenzenesulfonamide (PubChem CID 43017406) has the molecular formula C24H33N3O6S and a molecular weight of 491.61 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[4-[2-(4-methoxyphenoxy)ethyl]piperazine-1-carbonyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-3-[4-[2-(4-methoxyphenoxy)ethyl]piperazine-1-carbonyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43017406 |
| Molecular Formula | C24H33N3O6S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-(2-methoxyethyl)-3-[4-[2-(4-methoxyphenoxy)ethyl]piperazine-1-carbonyl]-4-methylbenzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)N2CCN(CCOc3ccc(OC)cc3)CC2)c1 |
| InChI | InChI=1S/C24H33N3O6S/c1-19-4-9-22(34(29,30)25-10-16-31-2)18-23(19)24(28)27-13-11-26(12-14-27)15-17-33-21-7-5-20(32-3)6-8-21/h4-9,18,25H,10-17H2,1-3H3 |
| InChIKey | STBNGJPRLMALON-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|