C18H30ClN3O4S — CID 119516887
3-[4-(1-aminoethyl)piperidine-1-carbonyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide;hydrochloride (PubChem CID 119516887) has the molecular formula C18H30ClN3O4S and a molecular weight of 419.98 g/mol. Its IUPAC name is 3-[4-(1-aminoethyl)piperidine-1-carbonyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide;hydrochloride.
| Compound Name | 3-[4-(1-aminoethyl)piperidine-1-carbonyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119516887 |
| Molecular Formula | C18H30ClN3O4S |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-[4-(1-aminoethyl)piperidine-1-carbonyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide;hydrochloride |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)N2CCC(C(C)N)CC2)c1.Cl |
| InChI | InChI=1S/C18H29N3O4S.ClH/c1-13-4-5-16(26(23,24)20-8-11-25-3)12-17(13)18(22)21-9-6-15(7-10-21)14(2)19;/h4-5,12,14-15,20H,6-11,19H2,1-3H3;1H |
| InChIKey | ZDWZZHJPGGPADS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|