C23H29FN2O4S — CID 60619054
3-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide (PubChem CID 60619054) has the molecular formula C23H29FN2O4S and a molecular weight of 448.56 g/mol. Its IUPAC name is 3-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide.
| Compound Name | 3-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60619054 |
| Molecular Formula | C23H29FN2O4S |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 3-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)N2CCC(Cc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C23H29FN2O4S/c1-17-3-8-21(31(28,29)25-11-14-30-2)16-22(17)23(27)26-12-9-19(10-13-26)15-18-4-6-20(24)7-5-18/h3-8,16,19,25H,9-15H2,1-2H3 |
| InChIKey | YFEVJNFFXHTRLC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|