C12H11NO5S2 — CID 114331354
5-[(2-hydroxyphenyl)methylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 114331354) has the molecular formula C12H11NO5S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 5-[(2-hydroxyphenyl)methylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(2-hydroxyphenyl)methylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114331354 |
| Molecular Formula | C12H11NO5S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 5-[(2-hydroxyphenyl)methylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCc2ccccc2O)s1 |
| InChI | InChI=1S/C12H11NO5S2/c14-9-4-2-1-3-8(9)7-13-20(17,18)11-6-5-10(19-11)12(15)16/h1-6,13-14H,7H2,(H,15,16) |
| InChIKey | IERBZSPVOXQXDJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|