C13H13NO5S2 — CID 61027894
5-[(2-hydroxy-2-phenylethyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 61027894) has the molecular formula C13H13NO5S2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 5-[(2-hydroxy-2-phenylethyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(2-hydroxy-2-phenylethyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61027894 |
| Molecular Formula | C13H13NO5S2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 5-[(2-hydroxy-2-phenylethyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCC(O)c2ccccc2)s1 |
| InChI | InChI=1S/C13H13NO5S2/c15-10(9-4-2-1-3-5-9)8-14-21(18,19)12-7-6-11(20-12)13(16)17/h1-7,10,14-15H,8H2,(H,16,17) |
| InChIKey | ALEMHMSUPXZCGN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |