C11H8INO4S2 — CID 54907564
5-[(4-iodophenyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 54907564) has the molecular formula C11H8INO4S2 and a molecular weight of 409.23 g/mol. Its IUPAC name is 5-[(4-iodophenyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(4-iodophenyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 54907564 |
| Molecular Formula | C11H8INO4S2 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 408.89 |
| IUPAC Name | 5-[(4-iodophenyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2ccc(I)cc2)s1 |
| InChI | InChI=1S/C11H8INO4S2/c12-7-1-3-8(4-2-7)13-19(16,17)10-6-5-9(18-10)11(14)15/h1-6,13H,(H,14,15) |
| InChIKey | DBYQHQTUMGHJAW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|