C8H6N2O5S2 — CID 62904176
5-(1,2-oxazol-4-ylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 62904176) has the molecular formula C8H6N2O5S2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 62904176 |
| Molecular Formula | C8H6N2O5S2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2cnoc2)s1 |
| InChI | InChI=1S/C8H6N2O5S2/c11-8(12)6-1-2-7(16-6)17(13,14)10-5-3-9-15-4-5/h1-4,10H,(H,11,12) |
| InChIKey | KMGAABNWECWBFH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |